C18H17ClN4O — CID 135630025
5-(2-chlorophenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135630025) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-chlorophenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135630025 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 5-(2-chlorophenyl)-2-piperidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N2CCCCC2)nc2nccc(-c3ccccc3Cl)c12 |
| InChI | InChI=1S/C18H17ClN4O/c19-14-7-3-2-6-12(14)13-8-9-20-16-15(13)17(24)22-18(21-16)23-10-4-1-5-11-23/h2-3,6-9H,1,4-5,10-11H2,(H,20,21,22,24) |
| InChIKey | DADYPGHRDXEGEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |