C21H17ClN4O — CID 135630023
5-(2-chlorophenyl)-2-(2-phenylethylamino)-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135630023) has the molecular formula C21H17ClN4O and a molecular weight of 376.85 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-(2-phenylethylamino)-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-chlorophenyl)-2-(2-phenylethylamino)-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135630023 |
| Molecular Formula | C21H17ClN4O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-(2-chlorophenyl)-2-(2-phenylethylamino)-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(NCCc2ccccc2)nc2nccc(-c3ccccc3Cl)c12 |
| InChI | InChI=1S/C21H17ClN4O/c22-17-9-5-4-8-15(17)16-11-13-23-19-18(16)20(27)26-21(25-19)24-12-10-14-6-2-1-3-7-14/h1-9,11,13H,10,12H2,(H2,23,24,25,26,27) |
| InChIKey | FZZKGLMIINVQRT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |