C20H19ClFN3O — CID 137235349
4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-(2-phenylethylamino)-1H-pyrimidin-6-one (PubChem CID 137235349) has the molecular formula C20H19ClFN3O and a molecular weight of 371.84 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-(2-phenylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-(2-phenylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137235349 |
| Molecular Formula | C20H19ClFN3O |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-2-(2-phenylethylamino)-1H-pyrimidin-6-one |
| SMILES | Cc1c(Cc2c(F)cccc2Cl)nc(NCCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C20H19ClFN3O/c1-13-18(12-15-16(21)8-5-9-17(15)22)24-20(25-19(13)26)23-11-10-14-6-3-2-4-7-14/h2-9H,10-12H2,1H3,(H2,23,24,25,26) |
| InChIKey | JWSNKCCZLDXAGG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |