C18H24N4O3 — CID 135470392
methyl N-[4-[(4-benzyl-5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]butyl]carbamate (PubChem CID 135470392) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl N-[4-[(4-benzyl-5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]butyl]carbamate.
| Compound Name | methyl N-[4-[(4-benzyl-5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 135470392 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl N-[4-[(4-benzyl-5-methyl-6-oxo-1H-pyrimidin-2-yl)amino]butyl]carbamate |
| SMILES | COC(=O)NCCCCNc1nc(Cc2ccccc2)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C18H24N4O3/c1-13-15(12-14-8-4-3-5-9-14)21-17(22-16(13)23)19-10-6-7-11-20-18(24)25-2/h3-5,8-9H,6-7,10-12H2,1-2H3,(H,20,24)(H2,19,21,22,23) |
| InChIKey | ZZGVWXQEDXZCIW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|