C17H24N4O2 — CID 136779629
6-benzyl-3-(3-butoxypropylamino)-4H-1,2,4-triazin-5-one (PubChem CID 136779629) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-benzyl-3-(3-butoxypropylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-(3-butoxypropylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779629 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 6-benzyl-3-(3-butoxypropylamino)-4H-1,2,4-triazin-5-one |
| SMILES | CCCCOCCCNc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H24N4O2/c1-2-3-11-23-12-7-10-18-17-19-16(22)15(20-21-17)13-14-8-5-4-6-9-14/h4-6,8-9H,2-3,7,10-13H2,1H3,(H2,18,19,21,22) |
| InChIKey | YZDCPQVCTXPQKX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|