C14H20N4OS — CID 135412192
6-benzyl-5-oxo-4H-1,2,4-triazine-3-thiolate;diethylazanium (PubChem CID 135412192) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 6-benzyl-5-oxo-4H-1,2,4-triazine-3-thiolate;diethylazanium.
| Compound Name | 6-benzyl-5-oxo-4H-1,2,4-triazine-3-thiolate;diethylazanium |
|---|---|
| PubChem CID | 135412192 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 6-benzyl-5-oxo-4H-1,2,4-triazine-3-thiolate;diethylazanium |
| SMILES | CC[NH2+]CC.O=c1[nH]c([S-])nnc1Cc1ccccc1 |
| InChI | InChI=1S/C10H9N3OS.C4H11N/c14-9-8(12-13-10(15)11-9)6-7-4-2-1-3-5-7;1-3-5-4-2/h1-5H,6H2,(H2,11,13,14,15);5H,3-4H2,1-2H3 |
| InChIKey | PQWIIEXETJUZOR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|