C14H17N5O — CID 135682730
6-benzyl-3-(2-but-1-enylhydrazinyl)-4H-1,2,4-triazin-5-one (PubChem CID 135682730) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 6-benzyl-3-(2-but-1-enylhydrazinyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-(2-but-1-enylhydrazinyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135682730 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 6-benzyl-3-(2-but-1-enylhydrazinyl)-4H-1,2,4-triazin-5-one |
| SMILES | CCC=CNNc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H17N5O/c1-2-3-9-15-18-14-16-13(20)12(17-19-14)10-11-7-5-4-6-8-11/h3-9,15H,2,10H2,1H3,(H2,16,18,19,20) |
| InChIKey | IKWYUKJCAZZTAE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|