C10H11N5O — CID 135408009
6-benzyl-3-hydrazinyl-4H-1,2,4-triazin-5-one (PubChem CID 135408009) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 6-benzyl-3-hydrazinyl-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-hydrazinyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135408009 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 6-benzyl-3-hydrazinyl-4H-1,2,4-triazin-5-one |
| SMILES | NNc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H11N5O/c11-13-10-12-9(16)8(14-15-10)6-7-4-2-1-3-5-7/h1-5H,6,11H2,(H2,12,13,15,16) |
| InChIKey | NEKXLDHACYGHCD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|