C15H14N4O2 — CID 135510455
6-benzyl-3-(furan-2-ylmethylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135510455) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 6-benzyl-3-(furan-2-ylmethylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-(furan-2-ylmethylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135510455 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-benzyl-3-(furan-2-ylmethylamino)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(NCc2ccco2)nnc1Cc1ccccc1 |
| InChI | InChI=1S/C15H14N4O2/c20-14-13(9-11-5-2-1-3-6-11)18-19-15(17-14)16-10-12-7-4-8-21-12/h1-8H,9-10H2,(H2,16,17,19,20) |
| InChIKey | KPWRHFCFYCBVSA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |