C16H22N4O2 — CID 136683781
3-(cyclooctylamino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 136683781) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-(cyclooctylamino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(cyclooctylamino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136683781 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-(cyclooctylamino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(NC2CCCCCCC2)nnc1Cc1ccco1 |
| InChI | InChI=1S/C16H22N4O2/c21-15-14(11-13-9-6-10-22-13)19-20-16(18-15)17-12-7-4-2-1-3-5-8-12/h6,9-10,12H,1-5,7-8,11H2,(H2,17,18,20,21) |
| InChIKey | SXQJHXREVOMLLM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |