C14H10F2N4O2 — CID 136779320
3-(2,5-difluoroanilino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 136779320) has the molecular formula C14H10F2N4O2 and a molecular weight of 304.26 g/mol. Its IUPAC name is 3-(2,5-difluoroanilino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2,5-difluoroanilino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779320 |
| Molecular Formula | C14H10F2N4O2 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-(2,5-difluoroanilino)-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(Nc2cc(F)ccc2F)nnc1Cc1ccco1 |
| InChI | InChI=1S/C14H10F2N4O2/c15-8-3-4-10(16)11(6-8)17-14-18-13(21)12(19-20-14)7-9-2-1-5-22-9/h1-6H,7H2,(H2,17,18,20,21) |
| InChIKey | INYFMFMHAOIMNW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |