C11H14N4O2 — CID 136779754
6-(furan-2-ylmethyl)-3-(propylamino)-4H-1,2,4-triazin-5-one (PubChem CID 136779754) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-(furan-2-ylmethyl)-3-(propylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(furan-2-ylmethyl)-3-(propylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779754 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 6-(furan-2-ylmethyl)-3-(propylamino)-4H-1,2,4-triazin-5-one |
| SMILES | CCCNc1nnc(Cc2ccco2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N4O2/c1-2-5-12-11-13-10(16)9(14-15-11)7-8-4-3-6-17-8/h3-4,6H,2,5,7H2,1H3,(H2,12,13,15,16) |
| InChIKey | LPMAJENKOLZDGT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |