C16H17N5O2 — CID 136778903
3-[4-(dimethylamino)anilino]-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 136778903) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 3-[4-(dimethylamino)anilino]-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[4-(dimethylamino)anilino]-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136778903 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-[4-(dimethylamino)anilino]-6-(furan-2-ylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | CN(C)c1ccc(Nc2nnc(Cc3ccco3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H17N5O2/c1-21(2)12-7-5-11(6-8-12)17-16-18-15(22)14(19-20-16)10-13-4-3-9-23-13/h3-9H,10H2,1-2H3,(H2,17,18,20,22) |
| InChIKey | MIABVEIVHLWBQD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|