C21H26N6O2 — CID 136779463
6-(furan-2-ylmethyl)-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one (PubChem CID 136779463) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 6-(furan-2-ylmethyl)-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(furan-2-ylmethyl)-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779463 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 6-(furan-2-ylmethyl)-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one |
| SMILES | CCCN1CCN(c2ccc(Nc3nnc(Cc4ccco4)c(=O)[nH]3)cc2)CC1 |
| InChI | InChI=1S/C21H26N6O2/c1-2-9-26-10-12-27(13-11-26)17-7-5-16(6-8-17)22-21-23-20(28)19(24-25-21)15-18-4-3-14-29-18/h3-8,14H,2,9-13,15H2,1H3,(H2,22,23,25,28) |
| InChIKey | DMSNJSRIPUXAFA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|