C22H26N6O — CID 136779454
6-phenyl-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one (PubChem CID 136779454) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 6-phenyl-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-phenyl-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779454 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 6-phenyl-3-[4-(4-propylpiperazin-1-yl)anilino]-4H-1,2,4-triazin-5-one |
| SMILES | CCCN1CCN(c2ccc(Nc3nnc(-c4ccccc4)c(=O)[nH]3)cc2)CC1 |
| InChI | InChI=1S/C22H26N6O/c1-2-12-27-13-15-28(16-14-27)19-10-8-18(9-11-19)23-22-24-21(29)20(25-26-22)17-6-4-3-5-7-17/h3-11H,2,12-16H2,1H3,(H2,23,24,26,29) |
| InChIKey | IRFYXXMTPZJJKX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|