C29H34N6O — CID 69009267
2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-6-phenyl-8-propylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 69009267) has the molecular formula C29H34N6O and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-6-phenyl-8-propylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-6-phenyl-8-propylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 69009267 |
| Molecular Formula | C29H34N6O |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-6-phenyl-8-propylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCn1c(=O)c(-c2ccccc2)cc2c(C)nc(Nc3ccc(N4CCN(CC)CC4)cc3)nc21 |
| InChI | InChI=1S/C29H34N6O/c1-4-15-35-27-25(20-26(28(35)36)22-9-7-6-8-10-22)21(3)30-29(32-27)31-23-11-13-24(14-12-23)34-18-16-33(5-2)17-19-34/h6-14,20H,4-5,15-19H2,1-3H3,(H,30,31,32) |
| InChIKey | CCNABHHWAIULFH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|