C27H32N6OS — CID 69012955
2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-8-propyl-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 69012955) has the molecular formula C27H32N6OS and a molecular weight of 488.66 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-8-propyl-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-8-propyl-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 69012955 |
| Molecular Formula | C27H32N6OS |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-8-propyl-6-thiophen-2-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCn1c(=O)c(-c2cccs2)cc2c(C)nc(Nc3ccc(N4CCN(CC)CC4)cc3)nc21 |
| InChI | InChI=1S/C27H32N6OS/c1-4-12-33-25-22(18-23(26(33)34)24-7-6-17-35-24)19(3)28-27(30-25)29-20-8-10-21(11-9-20)32-15-13-31(5-2)14-16-32/h6-11,17-18H,4-5,12-16H2,1-3H3,(H,28,29,30) |
| InChIKey | LZXHEMWTSKSSIP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|