C26H27N5OS — CID 16557769
N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 16557769) has the molecular formula C26H27N5OS and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 16557769 |
| Molecular Formula | C26H27N5OS |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cc(-c4cccs4)nn3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H27N5OS/c1-2-29-14-16-30(17-15-29)21-12-10-20(11-13-21)27-26(32)24-19-23(25-9-6-18-33-25)28-31(24)22-7-4-3-5-8-22/h3-13,18-19H,2,14-17H2,1H3,(H,27,32) |
| InChIKey | BXKHKQHRSZEFGY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|