C25H25N5O2 — CID 24586512
3-(furan-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1-phenylpyrazole-5-carboxamide (PubChem CID 24586512) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-(furan-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 24586512 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 3-(furan-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1-phenylpyrazole-5-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cc(-c4ccco4)nn3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H25N5O2/c1-28-13-15-29(16-14-28)20-11-9-19(10-12-20)26-25(31)23-18-22(24-8-5-17-32-24)27-30(23)21-6-3-2-4-7-21/h2-12,17-18H,13-16H2,1H3,(H,26,31) |
| InChIKey | KDDFRIJAXNBBAK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|