C24H22N4O3 — CID 42157664
3-(furan-2-yl)-N-(4-morpholin-4-ylphenyl)-1-phenylpyrazole-5-carboxamide (PubChem CID 42157664) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(4-morpholin-4-ylphenyl)-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-(furan-2-yl)-N-(4-morpholin-4-ylphenyl)-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42157664 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-(furan-2-yl)-N-(4-morpholin-4-ylphenyl)-1-phenylpyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1cc(-c2ccco2)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H22N4O3/c29-24(25-18-8-10-19(11-9-18)27-12-15-30-16-13-27)22-17-21(23-7-4-14-31-23)26-28(22)20-5-2-1-3-6-20/h1-11,14,17H,12-13,15-16H2,(H,25,29) |
| InChIKey | GHKNFKNKHNARMF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|