C25H23N5O2 — CID 2447508
N-(4-morpholin-4-ylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 2447508) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 2447508 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H23N5O2/c31-25(26-20-11-13-21(14-12-20)29-15-17-32-18-16-29)23-27-24(19-7-3-1-4-8-19)30(28-23)22-9-5-2-6-10-22/h1-14H,15-18H2,(H,26,31) |
| InChIKey | RZZOMNJNXAVRJM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|