C24H22N4O2 — CID 53167088
N-(4-morpholin-4-ylphenyl)-2-phenylimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 53167088) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-phenylimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-phenylimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 53167088 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-phenylimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1ccc2nc(-c3ccccc3)cn2c1 |
| InChI | InChI=1S/C24H22N4O2/c29-24(25-20-7-9-21(10-8-20)27-12-14-30-15-13-27)19-6-11-23-26-22(17-28(23)16-19)18-4-2-1-3-5-18/h1-11,16-17H,12-15H2,(H,25,29) |
| InChIKey | LBUDAEZOYJHXEY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|