About 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide
3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide (PubChem CID 78890017) has the molecular formula C23H16N4O3
and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide |
| PubChem CID | 78890017 |
| Molecular Formula | C23H16N4O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cnco2)cc1)c1cc(-c2ccco2)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H16N4O3/c28-23(25-17-10-8-16(9-11-17)22-14-24-15-30-22)20-13-19(21-7-4-12-29-21)26-27(20)18-5-2-1-3-6-18/h1-15H,(H,25,28) |
| InChIKey | DSKXEKZDUJLLSA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide?
The IUPAC name of 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide (CID 78890017) is 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide.
What is the SMILES notation for 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide?
The canonical SMILES for 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide is O=C(Nc1ccc(-c2cnco2)cc1)c1cc(-c2ccco2)nn1-c1ccccc1.
What is the InChIKey of 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide?
The InChIKey is DSKXEKZDUJLLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4O3/c28-23(25-17-10-8-16(9-11-17)22-14-24-15-30-22)20-13-19(21-7-4-12-29-21)26-27(20)18-5-2-1-3-6-18/h1-15H,(H,25,28).
What are the key properties of 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide?
3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide has a molecular weight of 396.41 g/mol, XLogP of 5.04, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-N-[4-(1,3-oxazol-5-yl)phenyl]-1-phenylpyrazole-5-carboxamide is sourced from PubChem (CID 78890017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).