C23H21N5O4 — CID 18228202
3-(furan-2-yl)-N'-[2-(4-methoxyanilino)acetyl]-1-phenylpyrazole-5-carbohydrazide (PubChem CID 18228202) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-(furan-2-yl)-N'-[2-(4-methoxyanilino)acetyl]-1-phenylpyrazole-5-carbohydrazide.
| Compound Name | 3-(furan-2-yl)-N'-[2-(4-methoxyanilino)acetyl]-1-phenylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 18228202 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-(furan-2-yl)-N'-[2-(4-methoxyanilino)acetyl]-1-phenylpyrazole-5-carbohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)c2cc(-c3ccco3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N5O4/c1-31-18-11-9-16(10-12-18)24-15-22(29)25-26-23(30)20-14-19(21-8-5-13-32-21)27-28(20)17-6-3-2-4-7-17/h2-14,24H,15H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | NRBJJBZYHQIBNJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|