C22H26N4O4 — CID 3293826
3-(furan-2-yl)-1-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide (PubChem CID 3293826) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide.
| Compound Name | 3-(furan-2-yl)-1-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3293826 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-(furan-2-yl)-1-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nc(-c3ccco3)cc2C(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26N4O4/c1-28-18-7-5-17(6-8-18)26-20(16-19(24-26)21-4-2-13-30-21)22(27)23-9-3-10-25-11-14-29-15-12-25/h2,4-8,13,16H,3,9-12,14-15H2,1H3,(H,23,27) |
| InChIKey | QSVHNNQFXQGFRR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|