C22H24Cl2N4O3 — CID 3546360
1-(3,4-dichlorophenyl)-3-(5-methylfuran-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide (PubChem CID 3546360) has the molecular formula C22H24Cl2N4O3 and a molecular weight of 463.37 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(5-methylfuran-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(5-methylfuran-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3546360 |
| Molecular Formula | C22H24Cl2N4O3 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(5-methylfuran-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCCN3CCOCC3)n(-c3ccc(Cl)c(Cl)c3)n2)o1 |
| InChI | InChI=1S/C22H24Cl2N4O3/c1-15-3-6-21(31-15)19-14-20(28(26-19)16-4-5-17(23)18(24)13-16)22(29)25-7-2-8-27-9-11-30-12-10-27/h3-6,13-14H,2,7-12H2,1H3,(H,25,29) |
| InChIKey | MAFQFCCLOKPSNC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|