C24H31N5O2 — CID 4297341
1-(2,5-dimethylphenyl)-3-(1-methylpyrrol-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide (PubChem CID 4297341) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(1-methylpyrrol-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(1-methylpyrrol-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4297341 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(1-methylpyrrol-2-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(C)c(-n2nc(-c3cccn3C)cc2C(=O)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C24H31N5O2/c1-18-7-8-19(2)22(16-18)29-23(17-20(26-29)21-6-4-10-27(21)3)24(30)25-9-5-11-28-12-14-31-15-13-28/h4,6-8,10,16-17H,5,9,11-15H2,1-3H3,(H,25,30) |
| InChIKey | GGQNDOGQPWZTSQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|