C27H34N4O4 — CID 3565112
3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide (PubChem CID 3565112) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3565112 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCN3CCOCC3)n(-c3ccc(C)cc3C)n2)c(OC)c1 |
| InChI | InChI=1S/C27H34N4O4/c1-19-6-9-24(20(2)16-19)31-25(27(32)28-10-5-11-30-12-14-35-15-13-30)18-23(29-31)22-8-7-21(33-3)17-26(22)34-4/h6-9,16-18H,5,10-15H2,1-4H3,(H,28,32) |
| InChIKey | CBHGUWUTSJJBDA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|