C31H34N4O4 — CID 42759058
[3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 42759058) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is [3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42759058 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | [3-(2,4-dimethoxyphenyl)-1-(2,4-dimethylphenyl)pyrazol-5-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(-c4ccc(OC)cc4OC)nn3-c3ccc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C31H34N4O4/c1-21-6-13-28(22(2)18-21)35-29(20-27(32-35)26-12-11-25(38-4)19-30(26)39-5)31(36)34-16-14-33(15-17-34)23-7-9-24(37-3)10-8-23/h6-13,18-20H,14-17H2,1-5H3 |
| InChIKey | DAJKHTILNZZJJW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|