C24H29ClN4O2 — CID 3514821
1-(3-chlorophenyl)-3-(5-methylfuran-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazole-5-carboxamide (PubChem CID 3514821) has the molecular formula C24H29ClN4O2 and a molecular weight of 440.98 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(5-methylfuran-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazole-5-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-3-(5-methylfuran-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3514821 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(5-methylfuran-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCCN3CCCCC3C)n(-c3cccc(Cl)c3)n2)o1 |
| InChI | InChI=1S/C24H29ClN4O2/c1-17-7-3-4-13-28(17)14-6-12-26-24(30)22-16-21(23-11-10-18(2)31-23)27-29(22)20-9-5-8-19(25)15-20/h5,8-11,15-17H,3-4,6-7,12-14H2,1-2H3,(H,26,30) |
| InChIKey | HKLRPXXCCVAUCH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|