C25H24N4O5 — CID 24583652
3-(furan-2-yl)-N'-(3-methoxy-4-propoxybenzoyl)-1-phenylpyrazole-5-carbohydrazide (PubChem CID 24583652) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is 3-(furan-2-yl)-N'-(3-methoxy-4-propoxybenzoyl)-1-phenylpyrazole-5-carbohydrazide.
| Compound Name | 3-(furan-2-yl)-N'-(3-methoxy-4-propoxybenzoyl)-1-phenylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24583652 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-(furan-2-yl)-N'-(3-methoxy-4-propoxybenzoyl)-1-phenylpyrazole-5-carbohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)c2cc(-c3ccco3)nn2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H24N4O5/c1-3-13-33-22-12-11-17(15-23(22)32-2)24(30)26-27-25(31)20-16-19(21-10-7-14-34-21)28-29(20)18-8-5-4-6-9-18/h4-12,14-16H,3,13H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | TZKDTAZOXOXVKB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|