C21H22N4O2S — CID 8839263
N'-(cyclohexanecarbonyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide (PubChem CID 8839263) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N'-(cyclohexanecarbonyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide.
| Compound Name | N'-(cyclohexanecarbonyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 8839263 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N'-(cyclohexanecarbonyl)-1-phenyl-3-thiophen-2-ylpyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCCC1)c1cc(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H22N4O2S/c26-20(15-8-3-1-4-9-15)22-23-21(27)18-14-17(19-12-7-13-28-19)24-25(18)16-10-5-2-6-11-16/h2,5-7,10-15H,1,3-4,8-9H2,(H,22,26)(H,23,27) |
| InChIKey | ZUTCUTMSVNKUAD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|