C19H18FN3OS — CID 42761837
[1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-piperidin-1-ylmethanone (PubChem CID 42761837) has the molecular formula C19H18FN3OS and a molecular weight of 355.44 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 42761837 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(-c2cccs2)nn1-c1ccc(F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H18FN3OS/c20-14-6-8-15(9-7-14)23-17(19(24)22-10-2-1-3-11-22)13-16(21-23)18-5-4-12-25-18/h4-9,12-13H,1-3,10-11H2 |
| InChIKey | IMSMHELNRIQBGX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |