C18H16FN3OS — CID 812780
[1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 812780) has the molecular formula C18H16FN3OS and a molecular weight of 341.41 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 812780 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [1-(4-fluorophenyl)-3-thiophen-2-ylpyrazol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(-c2cccs2)nn1-c1ccc(F)cc1)N1CCCC1 |
| InChI | InChI=1S/C18H16FN3OS/c19-13-5-7-14(8-6-13)22-16(18(23)21-9-1-2-10-21)12-15(20-22)17-4-3-11-24-17/h3-8,11-12H,1-2,9-10H2 |
| InChIKey | NYGDRTXIDJIGST-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |