C26H24ClN3OS — CID 4587521
(4-benzylpiperidin-1-yl)-[1-(4-chlorophenyl)-3-thiophen-2-ylpyrazol-5-yl]methanone (PubChem CID 4587521) has the molecular formula C26H24ClN3OS and a molecular weight of 462.02 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-(4-chlorophenyl)-3-thiophen-2-ylpyrazol-5-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-(4-chlorophenyl)-3-thiophen-2-ylpyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 4587521 |
| Molecular Formula | C26H24ClN3OS |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-(4-chlorophenyl)-3-thiophen-2-ylpyrazol-5-yl]methanone |
| SMILES | O=C(c1cc(-c2cccs2)nn1-c1ccc(Cl)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H24ClN3OS/c27-21-8-10-22(11-9-21)30-24(18-23(28-30)25-7-4-16-32-25)26(31)29-14-12-20(13-15-29)17-19-5-2-1-3-6-19/h1-11,16,18,20H,12-15,17H2 |
| InChIKey | JVMZILIFWFXZHQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |