C27H26N4OS — CID 5013335
[4-(3-phenylprop-2-enyl)piperazin-1-yl]-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone (PubChem CID 5013335) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is [4-(3-phenylprop-2-enyl)piperazin-1-yl]-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone.
| Compound Name | [4-(3-phenylprop-2-enyl)piperazin-1-yl]-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 5013335 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [4-(3-phenylprop-2-enyl)piperazin-1-yl]-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2cccs2)nn1-c1ccccc1)N1CCN(CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H26N4OS/c32-27(30-18-16-29(17-19-30)15-7-11-22-9-3-1-4-10-22)25-21-24(26-14-8-20-33-26)28-31(25)23-12-5-2-6-13-23/h1-14,20-21H,15-19H2 |
| InChIKey | WNWJPKUJGIWWBA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |