C19H19N3O2S — CID 17491687
(2-methylmorpholin-4-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone (PubChem CID 17491687) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is (2-methylmorpholin-4-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone.
| Compound Name | (2-methylmorpholin-4-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 17491687 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2-methylmorpholin-4-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-5-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(-c3cccs3)nn2-c2ccccc2)CCO1 |
| InChI | InChI=1S/C19H19N3O2S/c1-14-13-21(9-10-24-14)19(23)17-12-16(18-8-5-11-25-18)20-22(17)15-6-3-2-4-7-15/h2-8,11-12,14H,9-10,13H2,1H3 |
| InChIKey | FJFUYSPQZWOQRQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |