C19H17N3O4S — CID 124701077
1-phenyl-5-[(2R)-2-thiophen-2-ylmorpholine-4-carbonyl]pyrazole-3-carboxylic acid (PubChem CID 124701077) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-phenyl-5-[(2R)-2-thiophen-2-ylmorpholine-4-carbonyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-phenyl-5-[(2R)-2-thiophen-2-ylmorpholine-4-carbonyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 124701077 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-phenyl-5-[(2R)-2-thiophen-2-ylmorpholine-4-carbonyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)N2CCO[C@@H](c3cccs3)C2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H17N3O4S/c23-18(21-8-9-26-16(12-21)17-7-4-10-27-17)15-11-14(19(24)25)20-22(15)13-5-2-1-3-6-13/h1-7,10-11,16H,8-9,12H2,(H,24,25)/t16-/m1/s1 |
| InChIKey | WHDQKEDZAYWWKZ-MRXNPFEDSA-N |
| XLogP | 2.85 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |