C17H20N4O5S — CID 125152721
5-[(3R)-3-(methanesulfonamido)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid (PubChem CID 125152721) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 5-[(3R)-3-(methanesulfonamido)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid.
| Compound Name | 5-[(3R)-3-(methanesulfonamido)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 125152721 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 5-[(3R)-3-(methanesulfonamido)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid |
| SMILES | CS(=O)(=O)N[C@@H]1CCCN(C(=O)c2cc(C(=O)O)nn2-c2ccccc2)C1 |
| InChI | InChI=1S/C17H20N4O5S/c1-27(25,26)19-12-6-5-9-20(11-12)16(22)15-10-14(17(23)24)18-21(15)13-7-3-2-4-8-13/h2-4,7-8,10,12,19H,5-6,9,11H2,1H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | QAWPMXAHUVCABM-GFCCVEGCSA-N |
| XLogP | 0.72 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |