C9H15N5O3S — CID 113226212
N-[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methanesulfonamide (PubChem CID 113226212) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is N-[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 113226212 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-[1-(2H-triazole-4-carbonyl)piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)c2cn[nH]n2)C1 |
| InChI | InChI=1S/C9H15N5O3S/c1-18(16,17)12-7-3-2-4-14(6-7)9(15)8-5-10-13-11-8/h5,7,12H,2-4,6H2,1H3,(H,10,11,13) |
| InChIKey | UFRTZUHORLZTJU-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |