C13H21N5O2 — CID 74232620
N,N-diethyl-1-(2H-triazole-4-carbonyl)piperidine-3-carboxamide (PubChem CID 74232620) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N,N-diethyl-1-(2H-triazole-4-carbonyl)piperidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-(2H-triazole-4-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 74232620 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N,N-diethyl-1-(2H-triazole-4-carbonyl)piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)c2cn[nH]n2)C1 |
| InChI | InChI=1S/C13H21N5O2/c1-3-17(4-2)12(19)10-6-5-7-18(9-10)13(20)11-8-14-16-15-11/h8,10H,3-7,9H2,1-2H3,(H,14,15,16) |
| InChIKey | YPUNSGPHOWNNSR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |