C7H11N5O — CID 115301640
[(3R)-3-aminopyrrolidin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 115301640) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 115301640 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | N[C@@H]1CCN(C(=O)c2cn[nH]n2)C1 |
| InChI | InChI=1S/C7H11N5O/c8-5-1-2-12(4-5)7(13)6-3-9-11-10-6/h3,5H,1-2,4,8H2,(H,9,10,11)/t5-/m1/s1 |
| InChIKey | KFEKELFANZEXES-RXMQYKEDSA-N |
| XLogP | -1.02 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |