C8H13N5O — CID 63282840
[3-(aminomethyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 63282840) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 63282840 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | NCC1CCN(C(=O)c2cn[nH]n2)C1 |
| InChI | InChI=1S/C8H13N5O/c9-3-6-1-2-13(5-6)8(14)7-4-10-12-11-7/h4,6H,1-3,5,9H2,(H,10,11,12) |
| InChIKey | JEMMFJYJSKYETH-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |