C13H18ClN3O3S — CID 81231053
N-[1-(4-chloro-6-methylpyridine-3-carbonyl)piperidin-3-yl]methanesulfonamide (PubChem CID 81231053) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is N-[1-(4-chloro-6-methylpyridine-3-carbonyl)piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(4-chloro-6-methylpyridine-3-carbonyl)piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 81231053 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[1-(4-chloro-6-methylpyridine-3-carbonyl)piperidin-3-yl]methanesulfonamide |
| SMILES | Cc1cc(Cl)c(C(=O)N2CCCC(NS(C)(=O)=O)C2)cn1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-9-6-12(14)11(7-15-9)13(18)17-5-3-4-10(8-17)16-21(2,19)20/h6-7,10,16H,3-5,8H2,1-2H3 |
| InChIKey | FQWUWQHCUFLXKU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |