C13H16Br2N2O3S — CID 103907786
N-[1-(3,5-dibromobenzoyl)piperidin-3-yl]methanesulfonamide (PubChem CID 103907786) has the molecular formula C13H16Br2N2O3S and a molecular weight of 440.16 g/mol. Its IUPAC name is N-[1-(3,5-dibromobenzoyl)piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(3,5-dibromobenzoyl)piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 103907786 |
| Molecular Formula | C13H16Br2N2O3S |
| Molecular Weight | 440.16 g/mol |
| Exact Mass | 437.92 |
| IUPAC Name | N-[1-(3,5-dibromobenzoyl)piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)c2cc(Br)cc(Br)c2)C1 |
| InChI | InChI=1S/C13H16Br2N2O3S/c1-21(19,20)16-12-3-2-4-17(8-12)13(18)9-5-10(14)7-11(15)6-9/h5-7,12,16H,2-4,8H2,1H3 |
| InChIKey | NMCGNNIYTCKOQW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.16 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |