C14H18N4O4S — CID 51079185
N-[1-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperidin-3-yl]methanesulfonamide (PubChem CID 51079185) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[1-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 51079185 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[1-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)c2cc(-c3ccco3)[nH]n2)C1 |
| InChI | InChI=1S/C14H18N4O4S/c1-23(20,21)17-10-4-2-6-18(9-10)14(19)12-8-11(15-16-12)13-5-3-7-22-13/h3,5,7-8,10,17H,2,4,6,9H2,1H3,(H,15,16) |
| InChIKey | ZCVUFJYFTJEXSF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |