C17H21N3O2 — CID 43056712
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone (PubChem CID 43056712) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 43056712 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone |
| SMILES | O=C(c1cc(-c2ccco2)[nH]n1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C17H21N3O2/c21-17(15-10-14(18-19-15)16-6-3-9-22-16)20-8-7-12-4-1-2-5-13(12)11-20/h3,6,9-10,12-13H,1-2,4-5,7-8,11H2,(H,18,19) |
| InChIKey | LEBMLFPXQKEWEL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |