C13H13N3O5 — CID 129415638
(2R)-4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]morpholine-2-carboxylic acid (PubChem CID 129415638) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2R)-4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 129415638 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (2R)-4-[5-(furan-2-yl)-1H-pyrazole-3-carbonyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)c2cc(-c3ccco3)[nH]n2)CCO1 |
| InChI | InChI=1S/C13H13N3O5/c17-12(16-3-5-21-11(7-16)13(18)19)9-6-8(14-15-9)10-2-1-4-20-10/h1-2,4,6,11H,3,5,7H2,(H,14,15)(H,18,19)/t11-/m1/s1 |
| InChIKey | QJBVRCQHNRFTMU-LLVKDONJSA-N |
| XLogP | 0.60 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |