C17H18N6O2 — CID 121190596
[3-(4-cyclopropyltriazol-1-yl)pyrrolidin-1-yl]-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone (PubChem CID 121190596) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is [3-(4-cyclopropyltriazol-1-yl)pyrrolidin-1-yl]-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone.
| Compound Name | [3-(4-cyclopropyltriazol-1-yl)pyrrolidin-1-yl]-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 121190596 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [3-(4-cyclopropyltriazol-1-yl)pyrrolidin-1-yl]-[5-(furan-2-yl)-1H-pyrazol-3-yl]methanone |
| SMILES | O=C(c1cc(-c2ccco2)[nH]n1)N1CCC(n2cc(C3CC3)nn2)C1 |
| InChI | InChI=1S/C17H18N6O2/c24-17(14-8-13(18-19-14)16-2-1-7-25-16)22-6-5-12(9-22)23-10-15(20-21-23)11-3-4-11/h1-2,7-8,10-12H,3-6,9H2,(H,18,19) |
| InChIKey | FCXWYXFSDXJNIG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |