C10H15N5O — CID 146082322
3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxamide (PubChem CID 146082322) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | 3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 146082322 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(n2cc(C3CC3)nn2)C1 |
| InChI | InChI=1S/C10H15N5O/c11-10(16)14-4-3-8(5-14)15-6-9(12-13-15)7-1-2-7/h6-8H,1-5H2,(H2,11,16) |
| InChIKey | XZOTWZMFHCSBQZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |